60903-83-5 Usage
General Description
4-Chloro-2,3,5,6-tetrafluorobenzylchloride is a chemical compound with the molecular formula C7H2Cl5F4. It is a chlorinated benzyl chloride derivative that contains both chlorine and fluorine atoms. 4-Chloro-2,3,5,6-tetrafluorobenzylchloride is commonly used in organic synthesis as a reagent or intermediate for the production of various pharmaceuticals, agrochemicals, and other fine chemicals. It is known for its high reactivity and ability to undergo various chemical transformations, making it useful in a wide range of applications. Its unique chemical properties also make it a valuable building block for the development of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 60903-83-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,9,0 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 60903-83:
(7*6)+(6*0)+(5*9)+(4*0)+(3*3)+(2*8)+(1*3)=115
115 % 10 = 5
So 60903-83-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H2Cl2F4/c8-1-2-4(10)6(12)3(9)7(13)5(2)11/h1H2