61273-95-8 Usage
Chemical Class
Pyridinium salts
Explanation
The compound belongs to the class of pyridinium salts, which are organic compounds containing a positively charged nitrogen atom.
2. Quaternary Ammonium Compound
Explanation
It is a quaternary ammonium compound, meaning it contains a positively charged nitrogen atom bonded to four organic groups.
3. Benzyl Group
Explanation
The chemical structure includes a benzyl group, which is a phenylmethyl group (C6H5-CH2-) attached to the molecule.
4. Methoxyphenylmethyl Group
Explanation
The compound also contains a methoxyphenylmethyl group, which is a phenylmethyl group with a methoxy (-OCH3) substituent.
5. Dimethylpyridinium Group
Explanation
The structure features a dimethylpyridinium group, which is a pyridine ring with two methyl (-CH3) substituents.
6. Tetrahydro-2 Backbone
Explanation
The compound has a tetrahydro-2 backbone, indicating that the pyridine ring is partially saturated with four hydrogen atoms.
7. Hydrogen Oxalate Group
Explanation
The compound contains a hydrogen oxalate group, which is a salt formed from the reaction of oxalic acid and hydrogen ions (H+).
8. Pharmaceutical Applications
Explanation
Due to its unique structure and properties, the compound may have potential applications in the pharmaceutical industry for drug development.
9. Chemical Industry Applications
Explanation
The compound's properties may also make it useful in the chemical industry for various purposes, such as synthesis or catalysis.
10. Research Applications
Explanation
The compound's unique structure could be valuable for research purposes, particularly in the study of organic chemistry and the development of new synthetic methods.
Check Digit Verification of cas no
The CAS Registry Mumber 61273-95-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,2,7 and 3 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 61273-95:
(7*6)+(6*1)+(5*2)+(4*7)+(3*3)+(2*9)+(1*5)=118
118 % 10 = 8
So 61273-95-8 is a valid CAS Registry Number.
InChI:InChI=1/C22H27NO.C2H2O4/c1-17-13-14-23(16-20-7-5-4-6-8-20)22(18(17)2)15-19-9-11-21(24-3)12-10-19;3-1(4)2(5)6/h4-12,22H,13-16H2,1-3H3;(H,3,4)(H,5,6)