61757-59-3 Usage
General Description
Sodium Trideceth-12 Carboxylate is a chemical compound commonly used in personal care products such as shampoos and body washes as a surfactant and cleansing agent. It is a sodium salt derived from trideceth-12 carboxylic acid, a fatty acid that can be obtained from natural sources like coconut oil. This ingredient helps to remove dirt and oil from the skin and hair by lowering the surface tension of water, allowing it to interact more effectively with the substances being cleaned. It also helps to create a stable foam and improves the overall performance and feel of the product. Additionally, Sodium Trideceth-12 Carboxylate is considered to be a mild and gentle ingredient, making it suitable for use in various skincare and haircare formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 61757-59-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,7,5 and 7 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 61757-59:
(7*6)+(6*1)+(5*7)+(4*5)+(3*7)+(2*5)+(1*9)=143
143 % 10 = 3
So 61757-59-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H34O4.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-20-14-15-21-16-17(18)19;/h2-16H2,1H3,(H,18,19);/q;+1/p-1
