61787-10-8 Usage
Description
5-Chloro-5'-deoxy-5'-iodo-2',3'-O-isopropylidene-D-uridine is a chemical compound that serves as an intermediate in the synthesis of various pharmaceuticals. It is characterized by its unique molecular structure, which includes a chloro and iodo group, as well as a protected isopropylidene moiety.
Uses
Used in Pharmaceutical Industry:
5-Chloro-5'-deoxy-5'-iodo-2',3'-O-isopropylidene-D-uridine is used as an intermediate for the preparation of 5'-Deoxy-5-fluorouridine, a key compound in the synthesis of various therapeutic agents. This intermediate plays a crucial role in the development of drugs that target specific biological pathways and have potential applications in the treatment of various diseases.
Used in Organic Synthesis:
In addition to its pharmaceutical applications, 5-Chloro-5'-deoxy-5'-iodo-2',3'-O-isopropylidene-D-uridine can also be used as a building block in organic synthesis. Its unique functional groups and protected isopropylidene moiety make it a versatile compound for the synthesis of complex organic molecules with potential applications in various industries, such as materials science, agrochemicals, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 61787-10-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,7,8 and 7 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 61787-10:
(7*6)+(6*1)+(5*7)+(4*8)+(3*7)+(2*1)+(1*0)=138
138 % 10 = 8
So 61787-10-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H14FIN2O5/c1-12(2)20-7-6(3-14)19-10(8(7)21-12)16-4-5(13)9(17)15-11(16)18/h4,6-8,10H,3H2,1-2H3,(H,15,17,18)/t6-,7+,8?,10-/m1/s1
61787-10-8Relevant articles and documents
Process for the preparation of a deoxyuridine derivative
-
, (2008/06/13)
A process for the preparation of 5′-deoxy-5-fluorouridine, which comprises, the transformation of, 2′,3′-O-isopropylidene-5-fluorouridine in the corresponding 5′-O-sulfonyl derivative subsequent reaction with alkaline or earth-alkaline iodides and after hydrolysis of the isopropylidene group, reduction of the 5′-deoxy-5′-iodo-5 -fluorouridine thus obtained, is described.
