61985-25-9 Usage
Description
1-(1H-Imidazol-4-yl)-ethanone HCl, also known as Imidazolone, is an organic compound derived from the essential oil of Mirabilis Jalapa root. It is a photochemical compound with a unique chemical structure that consists of an imidazole ring attached to an ethanone group. 1-(1H-Imidazol-4-yl)-ethanone HCl exhibits various properties that make it suitable for a range of applications across different industries.
Uses
Used in Pharmaceutical Industry:
1-(1H-Imidazol-4-yl)-ethanone HCl is used as an active pharmaceutical ingredient for its potential therapeutic effects. 1-(1H-Imidazol-4-yl)-ethanone HCl's unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs to treat various diseases and medical conditions.
Used in Chemical Synthesis:
1-(1H-Imidazol-4-yl)-ethanone HCl serves as a key intermediate in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals. Its versatile chemical structure enables it to be used as a building block for the creation of a wide range of molecules with diverse applications.
Used in Research and Development:
As a photochemical compound, 1-(1H-Imidazol-4-yl)-ethanone HCl is utilized in research laboratories for studying its properties, reactivity, and potential applications. Researchers can use this compound to explore new reaction pathways, develop innovative synthetic methods, and gain insights into the underlying mechanisms of various chemical processes.
Used in Analytical Chemistry:
1-(1H-Imidazol-4-yl)-ethanone HCl can be employed as a reference compound or a standard in analytical chemistry for the calibration of instruments and the development of new analytical methods. Its unique chemical structure and properties make it a valuable tool for the accurate determination of various parameters in chemical analysis.
Used in Material Science:
1-(1H-Imidazol-4-yl)-ethanone HCl's photochemical properties and unique structure make it a potential candidate for the development of new materials with specific properties. It can be used in the design and synthesis of advanced materials for applications in areas such as electronics, optics, and sensors.
Check Digit Verification of cas no
The CAS Registry Mumber 61985-25-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,9,8 and 5 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 61985-25:
(7*6)+(6*1)+(5*9)+(4*8)+(3*5)+(2*2)+(1*5)=149
149 % 10 = 9
So 61985-25-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N2O.ClH/c1-4(8)5-2-6-3-7-5;/h2-3H,1H3,(H,6,7);1H
61985-25-9Relevant articles and documents
Iron-catalyzed domino decarboxylation-oxidation of α,β-unsaturated carboxylic acids enabled aldehyde C-H methylation
Gong, Pei-Xue,Xu, Fangning,Cheng, Lu,Gong, Xu,Zhang, Jie,Gu, Wei-Jin,Han, Wei
supporting information, p. 5905 - 5908 (2021/06/18)
A practical and general iron-catalyzed domino decarboxylation-oxidation of α,β-unsaturated carboxylic acids enabling aldehyde C-H methylation for the synthesis of methyl ketones has been developed. This mild, operationally simple method uses ambient air as the sole oxidant and tolerates sensitive functional groups for the late-stage functionalization of complex natural-product-derived and polyfunctionalized molecules.
SUBSTITUTED BIARYLS, PROCESS FOR THEIR MANUFACTURE AND USE THEREOF AS MEDICAMENTS
-
Page/Page column 48, (2010/11/30)
The present invention relates to compounds of general formula (I) wherein A, B, L, R1, R2, R3a and R3b are defined as in the specification, the tautomers, the enantiomers, the diastereomers, the mixtures thereof and the salts thereof, particularly the physiologically acceptable salts thereof with inorganic or organic acids or bases, which have valuable properties.
A GENERAL SYNTHESIS OF 4(5)-ACYLIMIDAZOLES FROM 4-ACYLAMINOISOXAZOLES.
Reiter, Lawrence A.
, p. 3423 - 3426 (2007/10/02)
2-Substituted-4(5)-acyl, 1,2-disubstituted 4-acyl and 1,2-disubstituted-5-acylimidazoles can be specifically prepared from 4-aminoisoxazoles.