6204-62-2 Usage
General Description
1-(2,3-dihydro-8-hydroxy-1,4-benzodioxin-5-yl)ethan-1-one is a chemical compound with a complex molecular structure. It contains a benzodioxin ring, which is a type of heterocyclic compound consisting of a benzene ring fused with a dioxin ring. The compound also contains a ketone group, which is a functional group characterized by a carbonyl group connected to two carbon atoms. Additionally, it has a hydroxy group, which consists of a hydrogen atom bonded to an oxygen atom, attached to the benzodioxin ring. Overall, 1-(2,3-dihydro-8-hydroxy-1,4-benzodioxin-5-yl)ethan-1-one is a unique and potentially versatile chemical compound with various applications in different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 6204-62-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,0 and 4 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6204-62:
(6*6)+(5*2)+(4*0)+(3*4)+(2*6)+(1*2)=72
72 % 10 = 2
So 6204-62-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O4/c1-6(11)7-2-3-8(12)10-9(7)13-4-5-14-10/h2-3,12H,4-5H2,1H3
