62100-28-1 Usage
Description
(1-METHYLENE-3-OXO-1,3-DIHYDRO-2H-ISOINDOL-2-YL)ACETIC ACID is a complex chemical compound that is a derivative of isoindoline. It features a methylene group, an oxo group, and a carboxylic acid group within its molecular structure. (1-METHYLENE-3-OXO-1,3-DIHYDRO-2H-ISOINDOL-2-YL)ACETIC ACID is widely recognized for its potential applications in the pharmaceutical industry, particularly as a building block in the synthesis of drugs and active pharmaceutical ingredients. Its unique structural attributes and biological activities have garnered significant interest in the realms of medicinal chemistry and drug discovery, solidifying its value within pharmaceutical science.
Used in Pharmaceutical Industry:
(1-METHYLENE-3-OXO-1,3-DIHYDRO-2H-ISOINDOL-2-YL)ACETIC ACID is used as a building block for the synthesis of various drugs and active pharmaceutical ingredients. Its complex molecular structure and potential medicinal properties make it a valuable component in creating new and effective medications.
Check Digit Verification of cas no
The CAS Registry Mumber 62100-28-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,1,0 and 0 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 62100-28:
(7*6)+(6*2)+(5*1)+(4*0)+(3*0)+(2*2)+(1*8)=71
71 % 10 = 1
So 62100-28-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO3/c1-7-8-4-2-3-5-9(8)11(15)12(7)6-10(13)14/h2-5H,1,6H2,(H,13,14)
