62253-94-5 Usage
General Description
2-(4-Aminobenzoyl)-2'-chloroacetanilide is a chemical compound with the molecular formula C15H14ClN3O2. It is a derivative of acetanilide and contains a benzene ring with an amino group and a benzoic acid group. The compound also has a chlorine atom attached to the acetanilide group. This chemical is commonly used in the production of pharmaceuticals, especially in the development of analgesic and anti-inflammatory medications. Its structure and properties make it a valuable building block in the synthesis of various drugs and pharmaceutical compounds. Additionally, its distinct molecular structure allows for targeted interactions with specific receptors and enzymes in the body, which makes it a valuable component in drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 62253-94-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,2,5 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 62253-94:
(7*6)+(6*2)+(5*2)+(4*5)+(3*3)+(2*9)+(1*4)=115
115 % 10 = 5
So 62253-94-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H13ClN2O2/c16-12-3-1-2-4-13(12)18-15(20)9-14(19)10-5-7-11(17)8-6-10/h1-8H,9,17H2,(H,18,20)