6289-08-3 Usage
Chemical structure
The compound has a pyrazolopyrimidine backbone with an attached methyl and 3-methylphenyl group.
Medicinal use
It is primarily used in the treatment of certain types of cancer, including non-small cell lung cancer and melanoma.
Mechanism of action
The compound works by inhibiting the activity of specific enzymes that promote the growth and spread of cancer cells.
Treatment combination
It is often used in combination with other cancer treatments, such as chemotherapy or immunotherapy.
Targeted therapy
1H-Pyrazolo[3,4-d]pyrimidin-4-amine,1-methyl-N-(3-methylphenyl)acts as a targeted therapy, specifically targeting the genetic mutations that drive the growth of cancer cells, making it a promising option for cancer treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 6289-08-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,8 and 9 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 6289-08:
(6*6)+(5*2)+(4*8)+(3*9)+(2*0)+(1*8)=113
113 % 10 = 3
So 6289-08-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H13N5/c1-9-4-3-5-10(6-9)17-12-11-7-16-18(2)13(11)15-8-14-12/h3-8H,1-2H3,(H,14,15,17)
