6300-81-8 Usage
Description
(3Z)-3-hydroxyiminocyclopentane-1-carboxylic acid is a cyclopentane-1-carboxylic acid derivative featuring a hydroxyl group and an imine functional group, with the "3Z" denoting the stereochemistry of the double bond in the cyclopentane ring. This chemical compound holds potential for applications in organic synthesis, medicinal chemistry, and as a precursor for more complex molecules, making it a subject of interest for scientific and industrial research.
Uses
Used in Organic Synthesis:
(3Z)-3-hydroxyiminocyclopentane-1-carboxylic acid is used as a synthetic intermediate for the creation of various organic compounds due to its unique structure and functional groups.
Used in Medicinal Chemistry:
(3Z)-3-hydroxyiminocyclopentane-1-carboxylic acid is used as a building block in the development of pharmaceuticals, potentially contributing to the synthesis of new drugs.
Used in Research and Development:
(3Z)-3-hydroxyiminocyclopentane-1-carboxylic acid is utilized in scientific research to explore its properties and potential applications across different fields, including the synthesis of novel complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 6300-81-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 0 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6300-81:
(6*6)+(5*3)+(4*0)+(3*0)+(2*8)+(1*1)=68
68 % 10 = 8
So 6300-81-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H9NO3/c8-6(9)4-1-2-5(3-4)7-10/h4,10H,1-3H2,(H,8,9)/b7-5+
