6302-61-0 Usage
Description
(dicyclopropylmethylideneamino) propanoate, with the molecular formula C11H15NO2, is a chemical compound belonging to the class of organic compounds known as alpha amino acids. These are amino acids where the amino group is attached to the carbon atom immediately next to the carboxyl group. As a derivative of propanoic acid, it features a distinctive dicyclopropylmethylideneamino group. Its potential applications in the pharmaceutical industry and as a building block in organic synthesis are currently under investigation, with further research needed to establish its specific properties and uses.
Uses
Used in Pharmaceutical Industry:
(dicyclopropylmethylideneamino) propanoate is used as a potential compound in the pharmaceutical industry due to its unique structure and classification as an alpha amino acid. Its properties may allow for the development of new drugs or therapeutic agents, although further research is required to confirm its efficacy and safety.
Used in Organic Synthesis:
In the field of organic synthesis, (dicyclopropylmethylideneamino) propanoate may serve as a valuable building block for the creation of more complex molecules. Its unique dicyclopropylmethylideneamino group could be exploited to synthesize novel compounds with specific functions or properties, contributing to the advancement of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 6302-61-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 2 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6302-61:
(6*6)+(5*3)+(4*0)+(3*2)+(2*6)+(1*1)=70
70 % 10 = 0
So 6302-61-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO2/c1-2-9(12)13-11-10(7-3-4-7)8-5-6-8/h7-8H,2-6H2,1H3
