6306-91-8 Usage
Synthetic compound
A compound that is artificially made, rather than occurring naturally in nature. This indicates that 1-methoxy-3-(4-phenylpiperazin-1-yl)propan-2-ol is created through chemical reactions in a laboratory setting.
Methoxy group
A chemical group consisting of an oxygen atom and a methyl group (CH3). The presence of this group in the compound suggests that it may have certain chemical properties related to the methoxy group, such as increased solubility or reactivity.
Phenylpiperazine group
A chemical group that is a structural component of the compound. This group is commonly found in certain types of antidepressant and antipsychotic medications, suggesting that 1-methoxy-3-(4-phenylpiperazin-1-yl)propan-2-ol may have potential psychoactive properties.
Propan-2-ol group
A chemical group that indicates the presence of an alcohol (hydroxyl) group in the compound. This suggests that the compound may have some solubility in water, making it useful for various medical applications.
Pharmaceutical industry use
1-methoxy-3-(4-phenylpiperazin-1-yl)propan-2-ol is often used as a potential candidate for the development of new drugs. This means that researchers and scientists are interested in studying this compound for its potential therapeutic effects and applications.
Further research and testing needed
While the presence of certain groups in the compound suggests potential uses and effects,
Check Digit Verification of cas no
The CAS Registry Mumber 6306-91-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 6 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6306-91:
(6*6)+(5*3)+(4*0)+(3*6)+(2*9)+(1*1)=88
88 % 10 = 8
So 6306-91-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H22N2O2/c1-18-12-14(17)11-15-7-9-16(10-8-15)13-5-3-2-4-6-13/h2-6,14,17H,7-12H2,1H3
