6307-56-8 Usage
Description
(4-dibromoarsanylphenyl)-(4-phenylphenyl)methanone is a chemical compound belonging to the arsanylphenylphenylmethanone family. It is characterized by the presence of arsanyl, phenyl, and methanone functional groups. This solid compound at room temperature is widely recognized as a crucial building block in organic synthesis, particularly for the production of pharmaceuticals and agrochemicals. Despite its potential toxicity due to the dibromoarsanyl group, which necessitates careful handling and safety measures, it remains a versatile and significant reagent in organic chemistry.
Uses
Used in Pharmaceutical Industry:
(4-dibromoarsanylphenyl)-(4-phenylphenyl)methanone serves as an essential building block in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties, contributing to advancements in medicinal chemistry.
Used in Agrochemical Industry:
Similarly, in the agrochemical sector, this compound acts as a vital component in the creation of pesticides and other agricultural chemicals. Its incorporation into these products can enhance their effectiveness in protecting crops and improving overall agricultural yields.
Used in Organic Synthesis Research:
(4-dibromoarsanylphenyl)-(4-phenylphenyl)methanone is also utilized as a reagent in organic synthesis research. Its distinctive functional groups make it a valuable tool for exploring new synthetic pathways and developing innovative chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 6307-56-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 7 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6307-56:
(6*6)+(5*3)+(4*0)+(3*7)+(2*5)+(1*6)=88
88 % 10 = 8
So 6307-56-8 is a valid CAS Registry Number.
InChI:InChI=1/C19H13AsBr2O/c21-20(22)18-12-10-17(11-13-18)19(23)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-13H