6307-91-1 Usage
General Description
2,6-dibromo-3,4,5-trimethoxy-benzoic acid is a compound with the chemical formula C11H11Br2O6. It is a derivative of benzoic acid, containing two bromine atoms and three methoxy groups attached to the benzene ring. This chemical is commonly used in organic synthesis and pharmaceutical research due to its potential medicinal properties. Its molecular structure and properties make it a valuable precursor in the synthesis of various bioactive compounds, including pharmaceuticals and agrochemicals. Additionally, it has been studied for its potential antioxidant and antitumor activities, making it a subject of interest in medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 6307-91-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 7 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6307-91:
(6*6)+(5*3)+(4*0)+(3*7)+(2*9)+(1*1)=91
91 % 10 = 1
So 6307-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H10Br2O5/c1-15-7-5(11)4(10(13)14)6(12)8(16-2)9(7)17-3/h1-3H3,(H,13,14)
