6318-19-0 Usage
General Description
(1-ethoxycarbonyl-2-pyridin-2-yl-ethyl) benzoate is a chemical compound with the molecular formula C20H19NO3. It is a member of the benzoic acid esters and is commonly used in the production of pharmaceuticals and agrochemicals. (1-ethoxycarbonyl-2-pyridin-2-yl-ethyl) benzoate is known for its pesticidal and antimicrobial properties, making it suitable for use in insecticides, fungicides, and bactericides. It is also used as a chemical intermediate in the synthesis of various organic compounds. The ethoxycarbonyl and pyridin-2-yl-ethyl groups contribute to its functional properties, making it a versatile and valuable chemical in the field of chemistry and chemical engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 6318-19-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 8 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 6318-19:
(6*6)+(5*3)+(4*1)+(3*8)+(2*1)+(1*9)=90
90 % 10 = 0
So 6318-19-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H17NO4/c1-2-21-17(20)15(12-14-10-6-7-11-18-14)22-16(19)13-8-4-3-5-9-13/h3-11,15H,2,12H2,1H3