6324-87-4 Usage
General Description
"2-(2,5-dioxopyrrolidin-3-yl)acetic acid" is a chemical compound that belongs to the class of pyrrolidinedione derivatives. It is also known as N-acetylglutamic acid, which is a substrate for the enzyme N-acetylglutamate synthetase. This enzyme is involved in the urea cycle, which helps in the removal of ammonia from the body by converting it into urea. The chemical compound has potential applications in pharmaceuticals and biotechnology due to its involvement in various metabolic processes. It plays a crucial role in the regulation of ureagenesis and may have therapeutic potential in treating urea cycle disorders. Additionally, it is also used as a component in some biochemical research and studies related to metabolic pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 6324-87-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,2 and 4 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6324-87:
(6*6)+(5*3)+(4*2)+(3*4)+(2*8)+(1*7)=94
94 % 10 = 4
So 6324-87-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO4/c8-4-1-3(2-5(9)10)6(11)7-4/h3H,1-2H2,(H,9,10)(H,7,8,11)