6334-31-2 Usage
Quinoline derivative
A compound based on the quinoline structure, which is a bicyclic aromatic compound consisting of a benzene ring fused to a pyridine ring.
Benzoyl group attachment
A benzoyl group (C6H5CO-) is attached to the quinoline ring, which is a derivative of benzoic acid.
Methoxy group attachment
A methoxy group (CH3O-) is attached to the quinoline ring, which is an alkoxy functional group derived from methanol (CH3OH).
Biological activities
Exhibits a range of biological activities, including antitumor, antimalarial, and anti-inflammatory properties.
Potential pharmaceutical drug development
The compound has been studied for its potential use in the development of new pharmaceutical drugs due to its diverse biological activities.
Enzyme inhibition
1-benzoyl-6-methoxy-2H-quinoline-2-carbonitrile has been investigated for its ability to inhibit the activity of certain enzymes, making it a promising candidate for further research.
Applications in medicinal chemistry and drug development
The compound's properties and potential applications make it a valuable subject for further research in the fields of medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 6334-31-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,3 and 4 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6334-31:
(6*6)+(5*3)+(4*3)+(3*4)+(2*3)+(1*1)=82
82 % 10 = 2
So 6334-31-2 is a valid CAS Registry Number.
InChI:InChI=1/C21H19BrN2O5/c1-11-5-6-15(7-12(11)2)24-20(26)16(19(25)23-21(24)27)9-13-8-14(22)10-17(28-3)18(13)29-4/h5-10H,1-4H3,(H,23,25,27)/b16-9+