63425-46-7 Usage
Molecular structure
A complex structure containing a quinolinium cation and an iodide anion.
Substituent groups
Consists of an ethyl group and a 3-ethyl-4-phenyl-3H-oxazol-2-ylidene group.
Potential applications
Organic synthesis, catalysts, and medicinal chemistry.
Unique features
The combination of quinolinium cation, iodide anion, and the substituent groups contribute to its unique properties.
Further research
Additional properties and potential uses may be discovered through ongoing research and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 63425-46-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,4,2 and 5 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 63425-46:
(7*6)+(6*3)+(5*4)+(4*2)+(3*5)+(2*4)+(1*6)=117
117 % 10 = 7
So 63425-46-7 is a valid CAS Registry Number.
InChI:InChI=1/C23H23N2O.HI/c1-3-24-20(15-14-19-12-8-9-13-21(19)24)16-23-25(4-2)22(17-26-23)18-10-6-5-7-11-18;/h5-17H,3-4H2,1-2H3;1H/q+1;/p-1