6345-78-4 Usage
General Description
2,2-bis(4-phenylphenoxy)acetic acid is a chemical compound with the molecular formula C30H24O5. It is a white solid that is used as a herbicide and plant growth regulator. 2,2-bis(4-phenylphenoxy)acetic acid is known for its ability to inhibit the growth of certain plants by disrupting their hormone balance, specifically by acting as an auxin mimic. It is commonly used in agricultural settings to control unwanted vegetation and promote desired plant growth. Additionally, it may have potential applications in pharmaceutical research and development due to its chemical structure and biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 6345-78-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,4 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 6345-78:
(6*6)+(5*3)+(4*4)+(3*5)+(2*7)+(1*8)=104
104 % 10 = 4
So 6345-78-4 is a valid CAS Registry Number.
InChI:InChI=1/C26H20O4/c27-25(28)26(29-23-15-11-21(12-16-23)19-7-3-1-4-8-19)30-24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18,26H,(H,27,28)