63547-59-1 Usage
Description
1-(1H-Pyrrol-2-yl)ethan-1-one oxime, an organic compound with the chemical formula C7H9NO, is a ketoxime derived from a ketone by the replacement of the carbonyl oxygen with NH2OH. This pale yellow solid is sparingly soluble in water and has a molecular weight of 123.15 g/mol. It is widely utilized in organic synthesis for the preparation of various nitrogen-containing compounds and has been investigated for its potential antimicrobial and anticancer properties.
Uses
Used in Organic Synthesis:
1-(1H-Pyrrol-2-yl)ethan-1-one oxime is used as a reagent in the organic synthesis industry for the preparation of nitrogen-containing compounds. Its unique ketoxime structure allows for versatile reactions and the creation of a diverse range of molecules with potential applications in various fields.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 1-(1H-Pyrrol-2-yl)ethan-1-one oxime is used as a compound of interest for its potential antimicrobial and anticancer properties. Researchers are exploring its biological activities to develop new drugs that could target and treat various diseases, particularly those related to microbial infections and cancer.
Used in Material Science:
Although not explicitly mentioned in the provided materials, 1-(1H-Pyrrol-2-yl)ethan-1-one oxime, due to its unique chemical structure, could potentially be used in material science for the development of novel materials with specific properties, such as conductivity or magnetism, depending on the context and requirements of the application.
Check Digit Verification of cas no
The CAS Registry Mumber 63547-59-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,5,4 and 7 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 63547-59:
(7*6)+(6*3)+(5*5)+(4*4)+(3*7)+(2*5)+(1*9)=141
141 % 10 = 1
So 63547-59-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O/c1-5(8-9)6-3-2-4-7-6/h2-4,8-9H,1H3/b6-5+
