63698-53-3 Usage
Description
5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-ol is a chemical compound characterized by its unique structure and properties. It is a derivative of oxadiazole, a five-membered heterocyclic ring containing two nitrogen atoms and one oxygen atom. The presence of trimethoxyphenyl group attached to the oxadiazole ring provides this compound with specific chemical and biological activities.
Uses
Used in Pharmaceutical Industry:
5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-ol is used as a screening agent for the discovery of novel d-amino acid oxidase inhibitors. Its unique structure allows it to interact with the enzyme, potentially leading to the development of new therapeutic agents for various diseases and conditions.
Used in Biochemical Research:
In the field of biochemistry, 5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-ol can be employed as a tool to study the function and regulation of d-amino acid oxidase. Understanding the interactions between this compound and the enzyme can provide valuable insights into the underlying mechanisms of related biological processes.
Used in Chemical Synthesis:
5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-ol may also find applications in chemical synthesis, particularly in the development of new molecules with potential pharmaceutical or industrial applications. Its unique structure and reactivity can be exploited to create novel compounds with specific properties and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 63698-53-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,6,9 and 8 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 63698-53:
(7*6)+(6*3)+(5*6)+(4*9)+(3*8)+(2*5)+(1*3)=163
163 % 10 = 3
So 63698-53-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O5/c1-15-7-4-6(10-12-13-11(14)18-10)5-8(16-2)9(7)17-3/h4-5H,1-3H3,(H,13,14)
