63704-54-1 Usage
General Description
2H-Cyclopenta[b]pyridin-2-one, 4-amino-1,5,6,7-tetrahydro-(9CI) is a chemical compound with the molecular formula C9H11NO. It is a tetrahydro derivative of pyridine, and it has a cyclic structure consisting of a five-membered ring fused to a six-membered ring. 2H-Cyclopenta[b]pyridin-2-one,4-amino-1,5,6,7-tetrahydro-(9CI) has an amino group (-NH2) attached to the four-carbon atom, making it a 4-amino tetrahydro derivative. It may have potential applications in the pharmaceutical and chemical industries due to its unique structure and properties. Further research and development may reveal its potential use in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 63704-54-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,7,0 and 4 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 63704-54:
(7*6)+(6*3)+(5*7)+(4*0)+(3*4)+(2*5)+(1*4)=121
121 % 10 = 1
So 63704-54-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O/c9-6-4-8(11)10-7-3-1-2-5(6)7/h4H,1-3H2,(H3,9,10,11)
