6371-38-6 Usage
Description
5,7-dichloro-2-(5,7-dichloro-1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro-3H-indol-3-one is a complex organic compound with a unique molecular structure. It exhibits properties such as red light blue color and is insoluble in ethanol. When treated with concentrated sulfuric acid, it turns blue light green, and upon dilution, it forms a blue precipitate. In a basic insurance powder solution, it exhibits a yellow color.
Uses
Used in Textile Industry:
5,7-dichloro-2-(5,7-dichloro-1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro-3H-indol-3-one is used as a dye for textiles. Its unique color properties and light fastness make it suitable for various applications in the textile industry.
Used in Dye Industry:
5,7-dichloro-2-(5,7-dichloro-1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro-3H-indol-3-one is used as a dye in the dye industry. Its color properties and light fastness make it a valuable component in the production of various dyes.
Used in Chemical Industry:
5,7-dichloro-2-(5,7-dichloro-1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro-3H-indol-3-one is used as a chemical intermediate in the chemical industry. Its unique molecular structure makes it a potential candidate for various chemical reactions and processes.
Used in Research and Development:
5,7-dichloro-2-(5,7-dichloro-1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro-3H-indol-3-one is used in research and development for its unique properties and potential applications in various fields. Its study can lead to the development of new products and technologies.
Preparation
(a)3,5-Dichloro-N-(carboxymethyl)anthranilic acid and Acetic anhydride reaction, with Sodium hydroxide product processing, then use air oxidation; (b) in Acetic anhydride and Sodium acetate trihydrate existence, 3H-indol-3-one,2-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,2-dihydro- in Acetic acid glacial chloride in four (FIAT 764). Commodity dyes for the three and tetrachloro indigo dye mixture.
Standard
Ironing Fastness
Fading
Stain
ISO
5
Check Digit Verification of cas no
The CAS Registry Mumber 6371-38-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,7 and 1 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 6371-38:
(6*6)+(5*3)+(4*7)+(3*1)+(2*3)+(1*8)=96
96 % 10 = 6
So 6371-38-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H6Cl4N2O2/c17-5-1-7-11(9(19)3-5)21-13(15(7)23)14-16(24)8-2-6(18)4-10(20)12(8)22-14/h1-4,21-22H/b14-13-