63811-40-5 Usage
Molecular structure
The compound has a complex molecular structure with multiple functional groups and two heterocyclic rings.
Functional groups
The compound contains ketones, hydroxyl groups, and thioxo groups.
Hetrocyclic rings
The compound features a tetrahydro-pyrimido ring and a hexahydro-pyrimido ring in its structure.
Potential pharmaceutical properties
The presence of these groups and rings gives the compound potential pharmaceutical properties.
Bioactivity
The compound may have bioactive properties, making it a subject of interest for further research and investigation.
Molecular weight
The molecular weight of the compound is approximately 360.4 g/mol.
Appearance
The compound is likely to be a solid, based on its molecular weight and complexity.
Solubility
The compound's solubility is not specified, but it may be soluble in organic solvents due to its nonpolar nature.
Stability
The stability of the compound is not specified, but it may be sensitive to heat, light, or moisture due to the presence of multiple functional groups.
Reactivity
The compound may be reactive with strong acids, bases, or oxidizing agents due to the presence of its functional groups.
Synthesis
The synthesis of the compound is not specified, but it may involve the formation of the heterocyclic rings and subsequent functionalization.
Applications
The compound's potential applications are not specified, but it may be used in the development of pharmaceuticals or other bioactive compounds.
Safety
The safety profile of the compound is not specified, but it may have potential hazards due to its complex structure and multiple functional groups.
Environmental impact
The environmental impact of the compound is not specified, but it may be considered a potential pollutant due to its complex structure and potential for bioaccumulation.
Check Digit Verification of cas no
The CAS Registry Mumber 63811-40-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,8,1 and 1 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 63811-40:
(7*6)+(6*3)+(5*8)+(4*1)+(3*1)+(2*4)+(1*0)=115
115 % 10 = 5
So 63811-40-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H10N4O4S2/c18-8-6(9(19)15-12(22)14-8)4-2-1-3-5-7-10(20)16-13(23)17-11(7)21/h1-6H,(H2,14,15,18,19,22)(H2,16,17,20,21,23)