63917-11-3 Usage
Description
(1-Ethoxyethylidene)malononitrile, with the chemical formula C7H8N2O2, is a colorless liquid that serves as a versatile building block in organic synthesis. It is particularly valuable in the production of pharmaceuticals and agrochemicals due to its ability to participate in various reactions, such as nucleophilic addition and condensation reactions.
Uses
Used in Pharmaceutical Industry:
(1-Ethoxyethylidene)malononitrile is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its reactivity and ability to undergo multiple types of chemical reactions make it an essential component in creating new and effective medications.
Used in Agrochemical Industry:
(1-ETHOXYETHYLIDENE)MALONONITRILE is also utilized as a building block in the development of agrochemicals, contributing to the creation of innovative products for agricultural applications, such as pesticides and herbicides.
Used in Organic Chemistry Research:
(1-Ethoxyethylidene)malononitrile serves as a reagent in organic and medicinal chemistry research, where its versatility in undergoing different reactions is crucial for exploring new chemical pathways and synthesizing novel organic compounds.
Used in Material Science:
(1-ETHOXYETHYLIDENE)MALONONITRILE's potential use in the development of new materials and compounds with specific properties makes it a valuable asset in material science, where it can contribute to the creation of advanced materials for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 63917-11-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,9,1 and 7 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 63917-11:
(7*6)+(6*3)+(5*9)+(4*1)+(3*7)+(2*1)+(1*1)=133
133 % 10 = 3
So 63917-11-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O/c1-2-10-4-3-7(5-8)6-9/h3H,2,4H2,1H3
