64-89-1 Usage
General Description
Propiomazine hydrochloride is a phenothiazine derivative with antipsychotic and sedative properties. It acts by blocking the dopamine receptors in the brain, leading to a reduction in psychotic symptoms. Propiomazine hydrochloride is primarily used to treat severe insomnia and other sleep disorders, as it has strong sedative effects. It also has antiemetic properties, making it useful in managing nausea and vomiting. Additionally, propiomazine hydrochloride has anxiolytic and muscle relaxant properties, making it a versatile medication for various conditions. However, it has a high potential for side effects, including drowsiness, dizziness, and impaired cognitive function, so it should only be used under the supervision of a healthcare professional.
Check Digit Verification of cas no
The CAS Registry Mumber 64-89-1 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 6 and 4 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 64-89:
(4*6)+(3*4)+(2*8)+(1*9)=61
61 % 10 = 1
So 64-89-1 is a valid CAS Registry Number.
InChI:InChI=1/C20H24N2OS.ClH/c1-5-18(23)15-10-11-17-20(12-15)24-19-9-7-6-8-16(19)22(17)14(2)13-21(3)4;/h6-12,14H,5,13H2,1-4H3;1H