64086-95-9 Usage
Chemical structure
A complex chemical compound with a long and specific name, consisting of several functional groups.
Functional groups
Contains an amino group, a bromo group, and an anthraquinone core.
Potential uses
May have various potential uses, such as in pharmaceuticals, dyes, or organic synthesis.
Research and testing
Due to its complex structure, further research and testing would be needed to fully understand its properties and potential applications.
Molecular weight
Approximately 520.37 g/mol (calculated from the molecular formula).
Appearance
Likely a solid, with a color that may be influenced by the anthraquinone core and other functional groups.
Solubility
Solubility in various solvents would depend on the specific functional groups and their interactions, but it may be soluble in organic solvents like dimethyl sulfoxide (DMSO) or methanol.
Stability
Stability under different conditions (e.g., temperature, pH, light exposure) would need to be determined through further research.
Reactivity
The reactivity of the compound with other chemicals or under specific conditions would also need to be investigated to understand its potential applications and limitations.
Check Digit Verification of cas no
The CAS Registry Mumber 64086-95-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,0,8 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 64086-95:
(7*6)+(6*4)+(5*0)+(4*8)+(3*6)+(2*9)+(1*5)=139
139 % 10 = 9
So 64086-95-9 is a valid CAS Registry Number.
InChI:InChI=1/C26H21BrN6O2/c1-13(2)29-25-31-24(14-8-4-3-5-9-14)32-26(33-25)30-18-12-17(27)21(28)20-19(18)22(34)15-10-6-7-11-16(15)23(20)35/h3-13H,28H2,1-2H3,(H2,29,30,31,32,33)