64201-64-5 Usage
Description
Quinoline N-oxide hydrate is a chemical compound derived from quinoline, which is an organic compound with a basic nitrogen-containing structure. It is characterized by the presence of an oxygen atom connected to the nitrogen atom, forming an oxide. QUINOLINE N-OXIDE HYDRATE is known for its ability to form complexes with various elements, particularly lanthanide chlorides.
Uses
Used in Analytical Chemistry:
Quinoline N-oxide hydrate is used as a reagent for the quantitative determination of nitrones. It plays a crucial role in the reaction with trifluoroacetic anhydride-sodium iodide, enabling the accurate measurement of nitrones, which are important intermediates in the synthesis of various pharmaceuticals and chemicals.
Used in Complex Formation:
In the field of coordination chemistry, Quinoline N-oxide hydrate is used for forming complexes with lanthanide chlorides. These complexes have potential applications in various areas, such as luminescent materials, catalysts, and magnetic materials, due to the unique properties of lanthanide elements.
Check Digit Verification of cas no
The CAS Registry Mumber 64201-64-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,2,0 and 1 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 64201-64:
(7*6)+(6*4)+(5*2)+(4*0)+(3*1)+(2*6)+(1*4)=95
95 % 10 = 5
So 64201-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO.H2O/c11-10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H;1H2
