642460-96-6 Usage
Description
2(1H)-Pyridinone, 6-amino-3-iodo-5-nitrois a chemical compound with the molecular formula C6H5IN2O3. It is a derivative of pyridinone and contains an amino group, an iodine atom, and a nitro group. 2(1H)-Pyridinone, 6-amino-3-iodo-5-nitrocan be used in organic synthesis as a building block for the preparation of various pharmaceuticals and bioactive molecules. It may also have potential applications in the development of new materials and as a reagent in chemical reactions. Furthermore, the presence of the nitro and amino groups in its structure may confer certain biological activities, making it of interest for medicinal chemistry research.
Uses
Used in Pharmaceutical Industry:
2(1H)-Pyridinone, 6-amino-3-iodo-5-nitrois used as a building block for the synthesis of various pharmaceuticals and bioactive molecules. Its unique structure with an amino group, an iodine atom, and a nitro group allows for the development of new drugs with potential therapeutic applications.
Used in Material Science:
2(1H)-Pyridinone, 6-amino-3-iodo-5-nitromay be used in the development of new materials due to its unique chemical properties. Its potential applications in material science could include the creation of novel polymers, coatings, or other advanced materials with specific properties.
Used as a Reagent in Chemical Reactions:
2(1H)-Pyridinone, 6-amino-3-iodo-5-nitrocan be used as a reagent in various chemical reactions, facilitating the synthesis of complex organic compounds. Its presence in these reactions can help to increase the efficiency and yield of desired products.
Used in Medicinal Chemistry Research:
Due to the presence of the nitro and amino groups in its structure, 2(1H)-Pyridinone, 6-amino-3-iodo-5-nitromay have certain biological activities. It is of interest for medicinal chemistry research, where it could be studied for its potential therapeutic effects or used as a starting point for the development of new drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 642460-96-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,4,2,4,6 and 0 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 642460-96:
(8*6)+(7*4)+(6*2)+(5*4)+(4*6)+(3*0)+(2*9)+(1*6)=156
156 % 10 = 6
So 642460-96-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H4IN3O3/c6-2-1-3(9(11)12)4(7)8-5(2)10/h1H,(H3,7,8,10)
642460-96-6Relevant articles and documents
Non-standard nucleoside analogs with reduced epimerization
-
, (2011/11/13)
This invention relates to nucleoside, nucleotide, and oligonucleotide analogs that incorporate non-standard nucleobase analogs, defined to be those that present a pattern of hydrogen bonds to a paired nucleobase analog in a complementary strand that is different from the pattern presented by adenine, guanine, cytosine, and thymine. The invention is specifically concerned with compositions of matter that present the donor-donor-acceptor, donor-acceptor-donor, and acceptor-donor-donor non-standard hydrogen bonding patterns on pyrimidine analogs, where nucleoside analogs bearing these pyrimidine analogs do not epimerize as easily as those known in the art. The heterocycles on these nucleoside analogs are diaminopyridines and aminopyridones that have electron withdrawing groups attached to the position analogous to the 5-position of the ring in standard pyrimidines, including nitro, cyano, and carboxylic acid derivatives.
