6435-75-2 Usage
General Description
4,5,6,7-TETRAHYDRO-2-BENZOTHIOPHENE-1-CARBOXYLIC ACID is a chemical compound with a molecular formula of C11H12O2S. It is a carboxylic acid derivative of benzothiophene, which is a heterocyclic compound containing a benzene ring fused to a thiophene ring. 4,5,6,7-TETRAHYDRO-2-BENZOTHIOPHENE-1-CARBOXYLIC ACID is used in the pharmaceutical industry as a building block for the synthesis of various drugs and active pharmaceutical ingredients. It has potential therapeutic applications due to its structural similarity to other biologically active compounds. The presence of a carboxylic acid functional group allows for further chemical modification and derivatization, making it a versatile intermediate in organic synthesis. Additionally, the compound may have potential applications in agrochemicals, dyes, and other specialty chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6435-75-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,4,3 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6435-75:
(6*6)+(5*4)+(4*3)+(3*5)+(2*7)+(1*5)=102
102 % 10 = 2
So 6435-75-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H15ClO5/c1-3-17-11-6-9(7-15)5-10(14)13(11)19-8-12(16)18-4-2/h5-7H,3-4,8H2,1-2H3
