64762-96-5 Usage
General Description
Diethyl 2,24-diacetyl-13-[6-[[2-(ethoxycarbonyl)-1,3-dioxobutyl]amino]hexyl]-3,12,14,23-tetraoxo-4,11,13,15,22-pentaazapentacosanedioate is a highly complex chemical compound with a long molecular structure. It contains multiple acetyl and oxo groups, as well as ethyl and amino groups, contributing to its high molecular weight and complexity. The compound is a pentaazapentacosanedioate derivative, and its intricate structure suggests that it may have applications in various fields of chemistry and biochemistry but could also pose potential hazards if mishandled. The name itself gives insight into the composition and arrangement of atoms in the compound, outlining its potential for a wide range of chemical reactions and interactions.
Check Digit Verification of cas no
The CAS Registry Mumber 64762-96-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,7,6 and 2 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 64762-96:
(7*6)+(6*4)+(5*7)+(4*6)+(3*2)+(2*9)+(1*6)=155
155 % 10 = 5
So 64762-96-5 is a valid CAS Registry Number.
InChI:InChI=1/C41H68N6O14/c1-7-59-37(54)31(28(4)48)34(51)42-22-16-10-12-19-25-45-40(57)47(27-21-15-14-18-24-44-36(53)33(30(6)50)39(56)61-9-3)41(58)46-26-20-13-11-17-23-43-35(52)32(29(5)49)38(55)60-8-2/h31-33H,7-27H2,1-6H3,(H,42,51)(H,43,52)(H,44,53)(H,45,57)(H,46,58)