65-68-9 Usage
General Description
5-(2'-chloroethyl)aminouracil is a chemical compound with the molecular formula C6H10ClN3O2. It is a derivative of the antineoplastic drug aminouracil, which is used in the treatment of certain types of cancer. 5-(2'-chloroethyl)aminouracil is a cytotoxic agent, which means it is capable of killing or inhibiting the growth of cancer cells. It works by interfering with the genetic material of cancer cells, leading to their destruction or inability to reproduce. The specific mechanism of action of 5-(2'-chloroethyl)aminouracil involves the formation of DNA adducts, which disrupt the normal function of DNA and ultimately lead to cell death. Due to its potential toxicity and side effects, the use of 5-(2'-chloroethyl)aminouracil is closely monitored and administered under medical supervision.
Check Digit Verification of cas no
The CAS Registry Mumber 65-68-9 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 6 and 5 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 65-68:
(4*6)+(3*5)+(2*6)+(1*8)=59
59 % 10 = 9
So 65-68-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H8ClN3O2/c7-1-2-8-4-3-9-6(12)10-5(4)11/h3,8H,1-2H2,(H2,9,10,11,12)
