651027-01-9 Usage
General Description
2-Bromo-3,5-difluorobenzoic acid is a chemical compound that belongs to the category of benzoic acids, which are organic compounds containing a carboxylic acid group attached to a benzene ring. This particular compound is characterized by the presence of two fluorine atoms and a bromine atom attached to the benzene ring. It has a molecular formula of C7H3BrF2O2 and a molecular weight of 233.998 g/mol. 2-Bromo-3,5-difluorobenzoic acid is often used in the synthesis of pharmaceutical compounds and agrochemicals. It has the potential to serve as a building block in various organic reactions and is valuable for research and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 651027-01-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,5,1,0,2 and 7 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 651027-01:
(8*6)+(7*5)+(6*1)+(5*0)+(4*2)+(3*7)+(2*0)+(1*1)=119
119 % 10 = 9
So 651027-01-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H3BrF2O2/c8-6-4(7(11)12)1-3(9)2-5(6)10/h1-2H,(H,11,12)
