652148-97-5 Usage
Description
5-BROMOPYRIDINE-2-BORONIC ACID is an organic compound characterized by the presence of a boronic acid group attached to a pyridine ring with a bromine atom at the 5th position. This unique structure endows it with versatile reactivity and properties, making it a valuable intermediate in organic synthesis and a potential candidate for various applications.
Uses
Used in Organic Synthesis:
5-BROMOPYRIDINE-2-BORONIC ACID is used as a synthetic intermediate for the preparation of various organic compounds, particularly in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals. Its reactivity allows for the formation of new bonds and the modification of existing ones, facilitating the creation of complex molecular structures.
Used in Medicinal Chemistry:
In the pharmaceutical industry, 5-BROMOPYRIDINE-2-BORONIC ACID is used as a building block for the development of new drugs and drug candidates. Its ability to participate in various chemical reactions, such as Suzuki-Miyaura cross-coupling, enables the synthesis of diverse bioactive molecules with potential therapeutic applications.
Used in the Synthesis of Halopyridinylboronic Acid Derivatives:
5-BROMOPYRIDINE-2-BORONIC ACID is used as a key component in the selective halogen-metal exchange of dihalopyridines. This process involves the use of nBuLi to facilitate the exchange, followed by quenching with triisopropylborate to yield halopyridinylboronic acid derivatives. These derivatives are valuable for further synthetic applications and can be used to access a range of functionalized pyridine-containing compounds.
Overall, 5-BROMOPYRIDINE-2-BORONIC ACID is a versatile and valuable compound with applications in organic synthesis, medicinal chemistry, and the preparation of halopyridinylboronic acid derivatives. Its unique structure and reactivity make it an essential tool for chemists and researchers in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 652148-97-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,5,2,1,4 and 8 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 652148-97:
(8*6)+(7*5)+(6*2)+(5*1)+(4*4)+(3*8)+(2*9)+(1*7)=165
165 % 10 = 5
So 652148-97-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BBrNO2/c7-4-1-2-5(6(9)10)8-3-4/h1-3,9-10H
