6527-75-9 Usage
Description
[4-[[4-(dimethylamino)-o-tolyl][4-(dimethylamino)phenyl]methylene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride is a complex organic chemical compound characterized by a cyclohexadiene ring with multiple dimethylamino groups attached to different aromatic rings. The presence of a chloride ion suggests that it is a salt. [4-[[4-(dimethylamino)-o-tolyl][4-(dimethylamino)phenyl]methylene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride, due to its unique structure and properties, may have potential applications in various fields such as medicine, materials science, and organic chemistry.
Uses
Used in Pharmaceutical Applications:
[4-[[4-(dimethylamino)-o-tolyl][4-(dimethylamino)phenyl]methylene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride is used as a pharmaceutical compound for its potential medicinal properties. The specific application reason is not provided in the materials, but its unique structure may offer novel interactions with biological targets, making it a candidate for drug development.
Used in Materials Science:
In the field of materials science, [4-[[4-(dimethylamino)-o-tolyl][4-(dimethylamino)phenyl]methylene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride is used as a component in the development of new materials. The application reason is its unique structural features, which may contribute to the creation of materials with specific properties, such as conductivity, stability, or reactivity.
Used in Organic Chemistry:
[4-[[4-(dimethylamino)-o-tolyl][4-(dimethylamino)phenyl]methylene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium chloride is used as a reagent or intermediate in organic synthesis. The application reason is its complex structure, which may facilitate the formation of new chemical bonds or the synthesis of other complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 6527-75-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,5,2 and 7 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6527-75:
(6*6)+(5*5)+(4*2)+(3*7)+(2*7)+(1*5)=109
109 % 10 = 9
So 6527-75-9 is a valid CAS Registry Number.
InChI:InChI=1/C26H32N3.ClH/c1-19-18-24(29(6)7)16-17-25(19)26(20-8-12-22(13-9-20)27(2)3)21-10-14-23(15-11-21)28(4)5;/h8-18H,1-7H3;1H/q+1;/p-1