65322-97-6 Usage
Description
Cysteine-beta-naphthylamide, also known as L-cysteine derivative, is an amide formed by the formal condensation of the carboxy group of L-cysteine with the amino group of 2-naphthylamine. It is a chemical compound with unique properties and potential applications in various fields.
Uses
Used in Chemical Research:
Cysteine-beta-naphthylamide is used as a research compound for studying the properties and behavior of L-cysteine and its derivatives. It helps researchers understand the structure, reactivity, and potential applications of this compound.
Used in Pharmaceutical Industry:
Cysteine-beta-naphthylamide is used as a pharmaceutical intermediate for the synthesis of various drugs and therapeutic agents. Its unique structure and properties make it a valuable component in the development of new medications.
Used in Biochemical Analysis:
Cysteine-beta-naphthylamide is used as a reagent in biochemical analysis for the detection and quantification of L-cysteine and related compounds. Its specific interaction with L-cysteine allows for accurate measurement and analysis in various biological systems.
Used in Cosmetic Industry:
Cysteine-beta-naphthylamide is used as an active ingredient in cosmetic products for its potential skin benefits. Its unique properties may contribute to improved skin health, appearance, and overall well-being.
Check Digit Verification of cas no
The CAS Registry Mumber 65322-97-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,3,2 and 2 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 65322-97:
(7*6)+(6*5)+(5*3)+(4*2)+(3*2)+(2*9)+(1*7)=126
126 % 10 = 6
So 65322-97-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2OS/c14-12(8-17)13(16)15-11-6-5-9-3-1-2-4-10(9)7-11/h1-7,12,17H,8,14H2,(H,15,16)/t12-/m0/s1
