65473-13-4 Usage
Description
N-Methyl-1-naphthalenemethylamine hydrochloride, also known as Terbinafine BP Impurity A and Terbinafine USP Related Compound A, is an off-white powder that serves as an intermediate in the synthesis of various pharmaceuticals. It plays a crucial role in the production of medications such as Terbinafine hydrochloride (T107500) and Butenafine hydrochloride (B690195).
Uses
Used in Pharmaceutical Industry:
N-Methyl-1-naphthalenemethylamine hydrochloride is used as a synthetic intermediate for the production of various pharmaceuticals. Its primary application is in the synthesis of Terbinafine hydrochloride (T107500) and Butenafine hydrochloride (B690195), which are widely used in the treatment of fungal infections. N-Methyl-1-naphthalenemethylamine hydrochloride's role in the pharmaceutical industry is essential for the development and manufacturing of these medications, contributing to the overall healthcare sector.
Check Digit Verification of cas no
The CAS Registry Mumber 65473-13-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,4,7 and 3 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 65473-13:
(7*6)+(6*5)+(5*4)+(4*7)+(3*3)+(2*1)+(1*3)=134
134 % 10 = 4
So 65473-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N/c1-13-9-11-7-4-6-10-5-2-3-8-12(10)11/h2-8,13H,9H2,1H3/p+1
65473-13-4Relevant articles and documents
Synthesis of potential inhibitors of squalenepoxidase with conformationanl fixation of the structural elements of Butenafine
Stanetty,Wallner
, p. 341 - 350 (2007/10/02)
The synthesis of the naphthalinemethanamines 6b-h is reported. To obtain products with conformative rigidity, substituents with gradually increased space demand were placed into the α-position. Since the direct reductive amination of the naphthylalkanones 3 with the amines 9 or 10 was only of very limited use the α-substituted naphthalinmethanamines 2 and 4 were synthesized as useful intermediates by various methods and the desired N-substitution pattern of the target compounds was subsequently built up applying - mostly reductive - alkylation methods.