6633-37-0 Usage
Description
3,5-diacetamido-4-methyl-benzoic acid is a chemical compound with the molecular formula C12H13N1O4. It belongs to the class of aromatic carboxylic acids and contains two acetamido groups and one methyl group. Its unique chemical structure and functional groups make it a versatile building block for the development of new pharmaceuticals.
Uses
Used in Pharmaceutical Industry:
3,5-diacetamido-4-methyl-benzoic acid is used as a building block for the synthesis of various drugs and pharmacologically active compounds. Its potential applications in the pharmaceutical industry make it a valuable compound for the development of new pharmaceuticals.
Used in Organic Chemistry:
3,5-diacetamido-4-methyl-benzoic acid may have potential applications in the field of organic chemistry due to its unique chemical structure and functional groups.
Used in Material Science:
3,5-diacetamido-4-methyl-benzoic acid may also have potential applications in the field of material science, where its unique properties can be utilized for the development of new materials.
Used in Medicinal Chemistry:
3,5-diacetamido-4-methyl-benzoic acid may have potential applications in the field of medicinal chemistry, where its unique chemical structure and functional groups can be used for the development of new therapeutic agents.
It is important to handle and use 3,5-diacetamido-4-methyl-benzoic acid with proper safety precautions and in accordance with all applicable regulations.
Check Digit Verification of cas no
The CAS Registry Mumber 6633-37-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,3 and 3 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6633-37:
(6*6)+(5*6)+(4*3)+(3*3)+(2*3)+(1*7)=100
100 % 10 = 0
So 6633-37-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H14N2O4/c1-6-10(13-7(2)15)4-9(12(17)18)5-11(6)14-8(3)16/h4-5H,1-3H3,(H,13,15)(H,14,16)(H,17,18)
