66353-71-7 Usage
Description
4-(Methylamino)-3-nitrophenyl phenyl ketone, also known as 4-Methylamino-3-nitro-benzophenone, is an organic compound that serves as an analog of the anti-parasitic drug Mebendazole (M200500). It is characterized by its unique molecular structure, which includes a nitro group and a methylamino group attached to a benzophenone backbone.
Uses
Used in Pharmaceutical Industry:
4-(Methylamino)-3-nitrophenyl phenyl ketone is used as a research compound for the development of new anti-parasitic drugs. Its structural similarity to Mebendazole allows scientists to study its potential as a treatment for parasitic infections, with the aim of improving upon the efficacy and safety of existing medications.
Additionally, due to its unique chemical properties, 4-(Methylamino)-3-nitrophenyl phenyl ketone may also be utilized in the synthesis of other related compounds with potential applications in various fields, such as materials science or chemical research. However, further investigation and development are required to fully explore and understand its capabilities and limitations in these areas.
Check Digit Verification of cas no
The CAS Registry Mumber 66353-71-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,3,5 and 3 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 66353-71:
(7*6)+(6*6)+(5*3)+(4*5)+(3*3)+(2*7)+(1*1)=137
137 % 10 = 7
So 66353-71-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N2O3/c1-15-12-8-7-11(9-13(12)16(18)19)14(17)10-5-3-2-4-6-10/h2-9,15H,1H3
