66675-73-8 Usage
Description
3,12-Dihydroxyhexadecanoic acid is a unique antineoplastic fatty acid characterized by the presence of two hydroxyl groups at the 3rd and 12th carbon positions. It exhibits significant potential in the field of oncology, particularly for leukemia treatments, due to its ability to target and inhibit cancer cell growth and proliferation.
Uses
Used in Pharmaceutical Industry:
3,12-Dihydroxyhexadecanoic acid is used as an antineoplastic agent for its potential application in leukemia treatments. It functions by interfering with the metabolic pathways of cancer cells, leading to the suppression of their growth and proliferation. This makes it a promising candidate for the development of novel therapeutic strategies against leukemia and possibly other types of cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 66675-73-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,6,7 and 5 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 66675-73:
(7*6)+(6*6)+(5*6)+(4*7)+(3*5)+(2*7)+(1*3)=168
168 % 10 = 8
So 66675-73-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H32O4/c1-2-3-10-14(17)11-8-6-4-5-7-9-12-15(18)13-16(19)20/h14-15,17-18H,2-13H2,1H3,(H,19,20)
