66755-26-8 Usage
Description
N-[5-[[bis(1,4-dihydro-4-oxo-2-quinazolinyl)methyl]azo]-9,10-dihydro-9,10-dioxo-1-anthryl]benzamide is a complex organic chemical compound characterized by a benzamide core structure with various functional groups, including quinazoline, anthryl, and azo groups. It has a molecular formula of C42H29N7O5 and a molecular weight of 721.72 g/mol. Further analysis and study are required to determine its chemical properties and potential applications.
Uses
As the provided materials do not specify any particular uses for N-[5-[[bis(1,4-dihydro-4-oxo-2-quinazolinyl)methyl]azo]-9,10-dihydro-9,10-dioxo-1-anthryl]benzamide, it is not possible to list any specific applications for this compound based on the given information. Further research and development would be necessary to explore its potential uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 66755-26-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,7,5 and 5 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 66755-26:
(7*6)+(6*6)+(5*7)+(4*5)+(3*5)+(2*2)+(1*6)=158
158 % 10 = 8
So 66755-26-8 is a valid CAS Registry Number.
InChI:InChI=1/C38H23N7O5/c46-32-24-15-9-19-28(30(24)33(47)23-14-8-18-27(29(23)32)41-36(48)20-10-2-1-3-11-20)44-45-31(34-39-25-16-6-4-12-21(25)37(49)42-34)35-40-26-17-7-5-13-22(26)38(50)43-35/h1-19,31H,(H,41,48)(H,39,42,49)(H,40,43,50)/b45-44+