66819-06-5 Usage
General Description
QUINOLIN-8-YLACETONITRILE, also known as 8-Quinolineacetonitrile, is a chemical compound with the molecular formula C11H8N2. It is a yellow crystalline solid that is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. QUINOLIN-8-YLACETONITRILE is mainly used as a building block in the production of various drugs, particularly antimalarial and antifungal agents. It is also used as a precursor for the synthesis of heterocyclic compounds and as a ligand in coordination chemistry. Additionally, QUINOLIN-8-YLACETONITRILE has potential application in OLEDs (organic light-emitting diodes) and other optoelectronic devices due to its electron-donating properties. Overall, this compound plays a crucial role in the development of various important chemical and pharmaceutical products.
Check Digit Verification of cas no
The CAS Registry Mumber 66819-06-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,8,1 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 66819-06:
(7*6)+(6*6)+(5*8)+(4*1)+(3*9)+(2*0)+(1*6)=155
155 % 10 = 5
So 66819-06-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2/c12-7-6-10-4-1-3-9-5-2-8-13-11(9)10/h1-5,8H,6H2