66900-68-3 Usage
Description
Platinum, (1,2-cyclohexanediamine-N,N')dinitrato-,(sp-4-2, 1R-trans)is a coordination complex of platinum with 1,2-cyclohexanediamine and dinitrato ligands, featuring the molecular formula Pt(C6H14N2)(NO2)2. This chemical compound is known for its unique structure and properties, making it a valuable and versatile compound for use in a variety of chemical processes.
Uses
Used in Coordination Chemistry:
Platinum, (1,2-cyclohexanediamine-N,N')dinitrato-,(sp-4-2, 1R-trans)is used as a coordination complex in coordination chemistry for its unique structure and properties, contributing to the understanding and development of new coordination compounds and their applications.
Used in Catalyst Applications:
In the field of catalysis, Platinum, (1,2-cyclohexanediamine-N,N')dinitrato-,(sp-4-2, 1R-trans)is used as a catalyst to facilitate various chemical reactions, enhancing the efficiency and selectivity of these processes.
Used in Pharmaceutical Industry:
Platinum, (1,2-cyclohexanediamine-N,N')dinitrato-,(sp-4-2, 1R-trans)is utilized in the pharmaceutical industry for its potential applications in drug development and as a catalyst in the synthesis of pharmaceutical compounds.
Used in Fine Chemicals Production:
Platinum, (1,2-cyclohexanediamine-N,N')dinitrato-,(sp-4-2, 1R-trans)is used in the production of fine chemicals, where its unique properties contribute to the synthesis and development of high-quality specialty chemicals.
Used in Specialty Materials Production:
Platinum, (1,2-cyclohexanediamine-N,N')dinitrato-,(sp-4-2, 1R-trans)is also employed in the production of specialty materials, where its coordination complex nature plays a crucial role in creating materials with specific properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 66900-68-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,9,0 and 0 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 66900-68:
(7*6)+(6*6)+(5*9)+(4*0)+(3*0)+(2*6)+(1*8)=143
143 % 10 = 3
So 66900-68-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N2.2HNO3.Pt/c7-5-3-1-2-4-6(5)8;2*2-1(3)4;/h5-8H,1-4H2;2*(H,2,3,4);/q-2;;;+2
66900-68-3Relevant articles and documents
Thermal degradation characteristics of selected organoplatinum antitumor agents
Howell,Beholz,Sastry
, p. 395 - 403 (2008/10/08)
The thermal decomposition characteristics of representatives of three classes of organoplatinum compounds have been examined by thermogravimetry. Substituted salicylato (1, 2-diaminocyclohexane)platinum(II) compounds undergo thermal decomposition by sequential loss of first the salicylato ligand and then the amine ligand to afford a residue corresponding to the platinum content of the compound. The thermal decomposition of N-arylsalicylaldimino(1,2-diaminocyclohexane)platinum(II) nitrate is more complex, but is also characterized by two major weight losses. Thermal decomposition of bis-(2-thiophenecarboxylato)platinum(II) is characterized by ligand fragmentation to generate a residual mass corresponding to the platinum content of the compound.
