67008-16-6 Usage
Description
(Z)-2-Methyl-2-butenoic acid (Z)-2-[[3-(7-methoxy-1,3-benzodioxole-5-yl)-2-propenyloxy]carbonyl]-2-butenyl ester is a complex ester derivative with the molecular formula C18H16O6. This colorless liquid chemical compound features a methoxy and benzodioxole group, and it is widely utilized in the production of pharmaceuticals, perfumes, and flavorings due to its potential biological activities. (Z)-2-Methyl-2-butenoic acid (Z)-2-[[3-(7-methoxy-1,3-benzodioxole-5-yl)-2-propenyloxy]carbonyl]-2-butenyl ester is currently under investigation in the pharmaceutical and chemical industries for its various applications.
Uses
Used in Pharmaceutical Industry:
(Z)-2-Methyl-2-butenoic acid (Z)-2-[[3-(7-methoxy-1,3-benzodioxole-5-yl)-2-propenyloxy]carbonyl]-2-butenyl ester is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique structure and potential biological activities make it a valuable component in the development of new drugs.
Used in Perfumery:
In the perfume industry, (Z)-2-Methyl-2-butenoic acid (Z)-2-[[3-(7-methoxy-1,3-benzodioxole-5-yl)-2-propenyloxy]carbonyl]-2-butenyl ester is used as a fragrance ingredient. Its distinct scent profile contributes to the creation of unique and complex fragrances.
Used in Flavor Industry:
(Z)-2-Methyl-2-butenoic acid (Z)-2-[[3-(7-methoxy-1,3-benzodioxole-5-yl)-2-propenyloxy]carbonyl]-2-butenyl ester is also employed in the flavor industry to enhance the taste and aroma of various food and beverage products. Its ability to impart specific flavor notes makes it a sought-after ingredient in the development of novel flavor compounds.
Ongoing Research:
(Z)-2-Methyl-2-butenoic acid (Z)-2-[[3-(7-methoxy-1,3-benzodioxole-5-yl)-2-propenyloxy]carbonyl]-2-butenyl ester is the subject of ongoing research in the pharmaceutical and chemical industries. Scientists are exploring its potential applications in various fields, including drug development, material science, and environmental chemistry, to unlock its full potential and contribute to the advancement of these industries.
Check Digit Verification of cas no
The CAS Registry Mumber 67008-16-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,0,0 and 8 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 67008-16:
(7*6)+(6*7)+(5*0)+(4*0)+(3*8)+(2*1)+(1*6)=116
116 % 10 = 6
So 67008-16-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H24O7/c1-5-14(3)20(22)26-12-16(6-2)21(23)25-9-7-8-15-10-17(24-4)19-18(11-15)27-13-28-19/h5-8,10-11H,9,12-13H2,1-4H3/b8-7+,14-5-,16-6-