67032-31-9 Usage
Description
3,5-Bis(hexanoylamino)-2,4,6-triiodobenzoic acid, also known as 3,5-Dihexanamido-2,4,6-triiodo-benzoic Acid, is a derivative of 3,5-Diamino-2,4,6-triiodobenzoic Acid (D416820). It is a metabolite of Diatrizoate, which possesses mutagenic and cytotoxic properties. 3,5-Bis(hexanoylamino)-2,4,6-triiodobenzoic acid is characterized by its unique chemical structure, which contributes to its potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
3,5-Bis(hexanoylamino)-2,4,6-triiodobenzoic acid is used as a pharmaceutical compound for its mutagenic and cytotoxic properties. Due to its ability to induce mutations and exhibit cytotoxic effects, it can be utilized in the development of drugs targeting specific diseases, particularly those requiring cell cycle disruption or inhibition of cell growth.
Used in Research and Development:
In the field of research and development, 3,5-Bis(hexanoylamino)-2,4,6-triiodobenzoic acid serves as a valuable tool for studying the mechanisms of mutagenesis and cytotoxicity. Its unique properties allow scientists to investigate the effects of this compound on cellular processes and potentially identify new therapeutic targets for various diseases.
Used in Toxicology Studies:
3,5-Bis(hexanoylamino)-2,4,6-triiodobenzoic acid is used as a test compound in toxicology studies to evaluate the potential hazards and risks associated with exposure to this substance. Understanding its mutagenic and cytotoxic effects can help in assessing its safety profile and determining appropriate guidelines for handling and disposal.
Used in Material Science:
The unique chemical structure of 3,5-Bis(hexanoylamino)-2,4,6-triiodobenzoic acid may also find applications in material science, particularly in the development of new materials with specific properties. Its potential use in this field could include the creation of novel compounds with tailored characteristics for various applications, such as sensors, catalysts, or advanced materials with unique optical, electronic, or mechanical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 67032-31-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,0,3 and 2 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 67032-31:
(7*6)+(6*7)+(5*0)+(4*3)+(3*2)+(2*3)+(1*1)=109
109 % 10 = 9
So 67032-31-9 is a valid CAS Registry Number.
InChI:InChI=1/C19H25I3N2O4/c1-3-5-7-9-11(25)23-17-14(20)13(19(27)28)15(21)18(16(17)22)24-12(26)10-8-6-4-2/h3-10H2,1-2H3,(H,23,25)(H,24,26)(H,27,28)