672310-05-3 Usage
General Description
ETHYL 2-(4'-PIPERIDINO)-1,3-OXAZOLE-4-CARBOXYLATE, also known as EPOC, is a chemical compound that belongs to the oxazole class of compounds. It is a synthetic compound that is primarily used in pharmaceutical research as a building block for the synthesis of other biologically active molecules. EPOC has been studied for its potential use in the development of new drugs, particularly in the field of neuroscience and central nervous system disorders. Its chemical structure contains a piperidine ring, an oxazole ring, and an ester functional group, which gives it its unique properties and potential pharmacological activities. The compound's structure makes it a promising candidate for further drug development and research.
Check Digit Verification of cas no
The CAS Registry Mumber 672310-05-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,2,3,1 and 0 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 672310-05:
(8*6)+(7*7)+(6*2)+(5*3)+(4*1)+(3*0)+(2*0)+(1*5)=133
133 % 10 = 3
So 672310-05-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2O3/c1-2-15-11(14)9-7-16-10(13-9)8-3-5-12-6-4-8/h7-8,12H,2-6H2,1H3
