67421-77-6 Usage
Chemical structure
A compound containing a dithiane group and a furan ring, which gives it unique reactivity and properties.
Usage
Employed as a building block for the preparation of various heterocyclic compounds and pharmaceutical drugs.
Application
Used in organic synthesis and medicinal chemistry.
Potential
Recognized for its potential as a versatile intermediate in the synthesis of biologically active compounds.
Extensive study
Has been extensively studied for its various applications in drug discovery and development.
Functional groups
Contains a carboxaldehyde group, which can participate in various chemical reactions such as nucleophilic addition, imine formation, and reduction.
Heterocyclic nature
The presence of both dithiane and furan rings classifies it as a heterocyclic compound, which often exhibits interesting biological activities.
Stability
The compound is generally stable under normal conditions, but may be sensitive to strong acids, bases, or oxidizing agents.
Solubility
Likely soluble in organic solvents such as dichloromethane, ethyl acetate, or acetone, due to its nonpolar nature.
Purity
The purity of the compound can be determined using techniques like chromatography or mass spectrometry, which are essential for its use in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 67421-77-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,4,2 and 1 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 67421-77:
(7*6)+(6*7)+(5*4)+(4*2)+(3*1)+(2*7)+(1*7)=136
136 % 10 = 6
So 67421-77-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H10O2S2/c10-7-9(8-3-1-4-11-8)12-5-2-6-13-9/h1,3-4,7H,2,5-6H2