67465-81-0 Usage
Chemical class
Heterocyclic compounds These are organic compounds containing a ring of atoms with at least one atom being different from carbon, such as nitrogen, oxygen, or sulfur.
Molecular structure
Pyridine ring fused to a benzothiazine ring The compound has a six-membered nitrogen-containing pyridine ring fused to a benzothiazine ring, which is a combination of a benzene and a thiazine ring.
Functional group
Piperidinopropyl group A piperidine ring (a five-membered nitrogen-containing ring) is attached to a propyl group (a three-carbon chain), which is further connected to the pyridine ring of the molecule.
Potential applications
Medicinal chemistry and pharmacology Due to its complex structure and potential biological activities, the compound may be useful in the development of new drugs or therapies.
Biological activities
Unknown at this time Further research is needed to determine the specific biological activities and potential therapeutic uses of the compound.
Research status
Further research warranted More studies are needed to fully understand the properties, potential applications, and safety of 10-(3-Piperidinopropyl)-10H-pyrido[3,2-b][1,4]benzothiazine.
Chemical properties
Unknown at this time The specific chemical properties, such as solubility, reactivity, and stability, are not provided in the material and would require further investigation.
Physical properties
Unknown at this time Information about the compound's physical properties, such as melting point, boiling point, and density, is not available in the material and would need to be determined through experimentation.
Synthesis
Not provided The method of synthesis for 10-(3-Piperidinopropyl)-10H-pyrido[3,2-b][1,4]benzothiazine is not mentioned in the material, and further research would be needed to develop a suitable synthesis route.
Safety and toxicity
Unknown at this time The safety and potential toxic effects of 10-(3-Piperidinopropyl)-10H-pyrido[3,2-b][1,4]benzothiazine are not provided in the material, and additional research would be necessary to evaluate these aspects.
Check Digit Verification of cas no
The CAS Registry Mumber 67465-81-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,4,6 and 5 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 67465-81:
(7*6)+(6*7)+(5*4)+(4*6)+(3*5)+(2*8)+(1*1)=160
160 % 10 = 0
So 67465-81-0 is a valid CAS Registry Number.
InChI:InChI=1/C19H23N3S/c1-4-12-21(13-5-1)14-7-15-22-16-8-2-3-9-17(16)23-18-10-6-11-20-19(18)22/h2-3,6,8-11H,1,4-5,7,12-15H2