675590-26-8 Usage
General Description
3-Bromo-5-(3-chlorophenyl)-pyridine is a chemical compound that belongs to the class of pyridines, which are heterocyclic compounds containing a ring structure with five carbon atoms and one nitrogen atom. This specific compound has a bromine atom at the 3-position, a 3-chlorophenyl group at the 5-position, and a pyridine ring. It is commonly used as a building block in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. The presence of both bromine and chlorophenyl groups makes it useful for various chemical reactions and as a starting material for the production of diverse organic compounds. Additionally, it has potential applications in the field of medicinal chemistry and drug discovery due to its structural features and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 675590-26-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,5,5,9 and 0 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 675590-26:
(8*6)+(7*7)+(6*5)+(5*5)+(4*9)+(3*0)+(2*2)+(1*6)=198
198 % 10 = 8
So 675590-26-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H7BrClN/c12-10-4-9(6-14-7-10)8-2-1-3-11(13)5-8/h1-7H