675602-92-3 Usage
General Description
2,3,6-Trifluoroisonicotinic acid is a fluorinated organic compound, classified as a derivative of isonicotinic acid. Its detailed information is guided by its unique CAS registry number 113402-89-3. The trifluoroisonicotinic acid component denotes the presence of three fluorine atoms in the molecular structure. Fluorine is known for increasing the bioavailability and stability of pharmaceutical compounds. This acid is most commonly used as a building block in the chemical and pharmaceutical industries, where it is often implemented in research and development for its bioactive properties. Specific details like the molecular weight, density, boiling point, melting point, etc. can be obtained from the material safety data sheets available for each chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 675602-92-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,5,6,0 and 2 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 675602-92:
(8*6)+(7*7)+(6*5)+(5*6)+(4*0)+(3*2)+(2*9)+(1*2)=183
183 % 10 = 3
So 675602-92-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H2F3NO2/c7-3-1-2(6(11)12)4(8)5(9)10-3/h1H,(H,11,12)
